C28H25F5O6S2 — CID 58445360
[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58445360) has the molecular formula C28H25F5O6S2 and a molecular weight of 616.63 g/mol. Its IUPAC name is [(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58445360 |
| Molecular Formula | C28H25F5O6S2 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | [(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CCC[C@@]3(S(=O)(=O)c4ccc(C(F)(F)F)cc4)c4c(F)ccc(F)c4OC[C@@H]23)cc1 |
| InChI | InChI=1S/C28H25F5O6S2/c1-17-4-8-21(9-5-17)41(36,37)39-15-18-3-2-14-27(22(18)16-38-26-24(30)13-12-23(29)25(26)27)40(34,35)20-10-6-19(7-11-20)28(31,32)33/h4-13,18,22H,2-3,14-16H2,1H3/t18-,22-,27-/m0/s1 |
| InChIKey | WCOPUEYHRMIGPF-PUIUQNQWSA-N |
| XLogP | 6.18 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|