C21H20F4O5S — CID 58445361
2-[(1S)-1-[(3S,4S)-4-(3,5-difluorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]but-3-enoxy]ethanol (PubChem CID 58445361) has the molecular formula C21H20F4O5S and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-[(1S)-1-[(3S,4S)-4-(3,5-difluorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]but-3-enoxy]ethanol.
| Compound Name | 2-[(1S)-1-[(3S,4S)-4-(3,5-difluorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]but-3-enoxy]ethanol |
|---|---|
| PubChem CID | 58445361 |
| Molecular Formula | C21H20F4O5S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-[(1S)-1-[(3S,4S)-4-(3,5-difluorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]but-3-enoxy]ethanol |
| SMILES | C=CC[C@H](OCCO)[C@@H]1COc2c(F)ccc(F)c2[C@H]1S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H20F4O5S/c1-2-3-18(29-7-6-26)15-11-30-20-17(25)5-4-16(24)19(20)21(15)31(27,28)14-9-12(22)8-13(23)10-14/h2,4-5,8-10,15,18,21,26H,1,3,6-7,11H2/t15-,18-,21-/m0/s1 |
| InChIKey | LJCWXHGTAQKBSR-XERREHJYSA-N |
| XLogP | 3.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|