C18H13F5O4S — CID 58445370
dimethyl 2-[(3,5-difluorophenyl)sulfanyl-(2,3,6-trifluorophenyl)methyl]propanedioate (PubChem CID 58445370) has the molecular formula C18H13F5O4S and a molecular weight of 420.36 g/mol. Its IUPAC name is dimethyl 2-[(3,5-difluorophenyl)sulfanyl-(2,3,6-trifluorophenyl)methyl]propanedioate.
| Compound Name | dimethyl 2-[(3,5-difluorophenyl)sulfanyl-(2,3,6-trifluorophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 58445370 |
| Molecular Formula | C18H13F5O4S |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | dimethyl 2-[(3,5-difluorophenyl)sulfanyl-(2,3,6-trifluorophenyl)methyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(Sc1cc(F)cc(F)c1)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C18H13F5O4S/c1-26-17(24)14(18(25)27-2)16(13-11(21)3-4-12(22)15(13)23)28-10-6-8(19)5-9(20)7-10/h3-7,14,16H,1-2H3 |
| InChIKey | SLMUMXLOSQMYOA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|