C22H20N2O8S2 — CID 58445453
[2-[cyano(isocyano)methylidene]-4-(2-methyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-7-yl] 2-methyl-1,3-dioxane-5-carboxylate (PubChem CID 58445453) has the molecular formula C22H20N2O8S2 and a molecular weight of 504.54 g/mol. Its IUPAC name is [2-[cyano(isocyano)methylidene]-4-(2-methyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-7-yl] 2-methyl-1,3-dioxane-5-carboxylate.
| Compound Name | [2-[cyano(isocyano)methylidene]-4-(2-methyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-7-yl] 2-methyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 58445453 |
| Molecular Formula | C22H20N2O8S2 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | [2-[cyano(isocyano)methylidene]-4-(2-methyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-7-yl] 2-methyl-1,3-dioxane-5-carboxylate |
| SMILES | [C-]#[N+]C(C#N)=C1Sc2c(OC(=O)C3COC(C)OC3)ccc(OC(=O)C3COC(C)OC3)c2S1 |
| InChI | InChI=1S/C22H20N2O8S2/c1-11-27-7-13(8-28-11)20(25)31-16-4-5-17(32-21(26)14-9-29-12(2)30-10-14)19-18(16)33-22(34-19)15(6-23)24-3/h4-5,11-14H,7-10H2,1-2H3 |
| InChIKey | WEMDAUYFSAFNSY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|