C27H30N2O7S2 — CID 58445466
[4-(4-methylcyclohexanecarbonyl)oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 58445466) has the molecular formula C27H30N2O7S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is [4-(4-methylcyclohexanecarbonyl)oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-(4-methylcyclohexanecarbonyl)oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58445466 |
| Molecular Formula | C27H30N2O7S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | [4-(4-methylcyclohexanecarbonyl)oxy-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(C)CC3)c3c2SC(=C2C(=O)NC(=O)NC2=O)S3)CC1 |
| InChI | InChI=1S/C27H30N2O7S2/c1-13-3-7-15(8-4-13)24(32)35-17-11-12-18(36-25(33)16-9-5-14(2)6-10-16)21-20(17)37-26(38-21)19-22(30)28-27(34)29-23(19)31/h11-16H,3-10H2,1-2H3,(H2,28,29,30,31,34) |
| InChIKey | YZXGPMASQFTQDN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|