About [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate
[2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate (PubChem CID 58445476) has the molecular formula C26H16N2O4S2
and a molecular weight of 484.56 g/mol. Its IUPAC name is [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate |
| PubChem CID | 58445476 |
| Molecular Formula | C26H16N2O4S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate |
| SMILES | [C-]#[N+]C(C#N)=C1Sc2c(OC(=O)c3ccc(C)cc3)ccc(OC(=O)c3ccc(C)cc3)c2S1 |
| InChI | InChI=1S/C26H16N2O4S2/c1-15-4-8-17(9-5-15)24(29)31-20-12-13-21(32-25(30)18-10-6-16(2)7-11-18)23-22(20)33-26(34-23)19(14-27)28-3/h4-13H,1-2H3 |
| InChIKey | XAZBUBZOUPSOEU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate?
The IUPAC name of [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate (CID 58445476) is [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate.
What is the SMILES notation for [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate?
The canonical SMILES for [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate is [C-]#[N+]C(C#N)=C1Sc2c(OC(=O)c3ccc(C)cc3)ccc(OC(=O)c3ccc(C)cc3)c2S1.
What is the InChIKey of [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate?
The InChIKey is XAZBUBZOUPSOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N2O4S2/c1-15-4-8-17(9-5-15)24(29)31-20-12-13-21(32-25(30)18-10-6-16(2)7-11-18)23-22(20)33-26(34-23)19(14-27)28-3/h4-13H,1-2H3.
What are the key properties of [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate?
[2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate has a molecular weight of 484.56 g/mol, XLogP of 6.55, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[cyano(isocyano)methylidene]-4-(4-methylbenzoyl)oxy-1,3-benzodithiol-7-yl] 4-methylbenzoate is sourced from PubChem (CID 58445476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).