C25H37F7O9S — CID 58445548
1-O-(3,3,4,4,5,5,5-heptafluoropentyl) 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 58445548) has the molecular formula C25H37F7O9S and a molecular weight of 646.62 g/mol. Its IUPAC name is 1-O-(3,3,4,4,5,5,5-heptafluoropentyl) 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-(3,3,4,4,5,5,5-heptafluoropentyl) 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58445548 |
| Molecular Formula | C25H37F7O9S |
| Molecular Weight | 646.62 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 1-O-(3,3,4,4,5,5,5-heptafluoropentyl) 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)OC)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H37F7O9S/c1-7-22(5,20(37)39-9-8-23(26,27)24(28,29)25(30,31)32)14-21(3,4)19(36)41-11-16(33)10-40-17(34)13-42-12-15(2)18(35)38-6/h15-16,33H,7-14H2,1-6H3 |
| InChIKey | VKZNXMQPSPVVJS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|