C27H37F11O9S — CID 58445549
1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 58445549) has the molecular formula C27H37F11O9S and a molecular weight of 746.63 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58445549 |
| Molecular Formula | C27H37F11O9S |
| Molecular Weight | 746.63 g/mol |
| Exact Mass | 746.20 |
| IUPAC Name | 1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)OC)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H37F11O9S/c1-7-22(5,20(43)45-9-8-23(28,29)24(30,31)25(32,33)26(34,35)27(36,37)38)14-21(3,4)19(42)47-11-16(39)10-46-17(40)13-48-12-15(2)18(41)44-6/h15-16,39H,7-14H2,1-6H3 |
| InChIKey | KXGYAQYCKCSAJM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|