About 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium
10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium (PubChem CID 58445563) has the molecular formula C24H25OS+
and a molecular weight of 361.53 g/mol. Its IUPAC name is 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium.
Molecular Properties
| Compound Name | 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium |
| PubChem CID | 58445563 |
| Molecular Formula | C24H25OS+ |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium |
| SMILES | Cc1cc([S+]2c3ccccc3Oc3ccccc32)cc(C)c1C(C)(C)C |
| InChI | InChI=1S/C24H25OS/c1-16-14-18(15-17(2)23(16)24(3,4)5)26-21-12-8-6-10-19(21)25-20-11-7-9-13-22(20)26/h6-15H,1-5H3/q+1 |
| InChIKey | BLSARIKPSXYDIG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium?
The IUPAC name of 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium (CID 58445563) is 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium.
What is the SMILES notation for 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium?
The canonical SMILES for 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium is Cc1cc([S+]2c3ccccc3Oc3ccccc32)cc(C)c1C(C)(C)C.
What is the InChIKey of 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium?
The InChIKey is BLSARIKPSXYDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25OS/c1-16-14-18(15-17(2)23(16)24(3,4)5)26-21-12-8-6-10-19(21)25-20-11-7-9-13-22(20)26/h6-15H,1-5H3/q+1.
What are the key properties of 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium?
10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium has a molecular weight of 361.53 g/mol, XLogP of 6.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-tert-butyl-3,5-dimethylphenyl)phenoxathiin-10-ium is sourced from PubChem (CID 58445563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).