C17H26O6 — CID 58445577
spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclopentane]-9-yl 2,2-dimethylbutanoate (PubChem CID 58445577) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclopentane]-9-yl 2,2-dimethylbutanoate.
| Compound Name | spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclopentane]-9-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58445577 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclopentane]-9-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1COC2C1OC1OC3(CCCC3)OC12 |
| InChI | InChI=1S/C17H26O6/c1-4-16(2,3)15(18)20-10-9-19-12-11(10)21-14-13(12)22-17(23-14)7-5-6-8-17/h10-14H,4-9H2,1-3H3 |
| InChIKey | JQVFCGGXEDEPLB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |