C10H13F3O3S — CID 58445654
2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropane-2-sulfonic acid (PubChem CID 58445654) has the molecular formula C10H13F3O3S and a molecular weight of 270.27 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropane-2-sulfonic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 58445654 |
| Molecular Formula | C10H13F3O3S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropane-2-sulfonic acid |
| SMILES | CC(C1CC2C=CC1C2)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C10H13F3O3S/c1-9(10(11,12)13,17(14,15)16)8-5-6-2-3-7(8)4-6/h2-3,6-8H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | IZTDUCCFAUBFQI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|