C16H21F3O3S — CID 58445662
1,1,1-trifluoro-2-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propane-2-sulfonic acid (PubChem CID 58445662) has the molecular formula C16H21F3O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propane-2-sulfonic acid.
| Compound Name | 1,1,1-trifluoro-2-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 58445662 |
| Molecular Formula | C16H21F3O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1,1,1-trifluoro-2-methyl-3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propane-2-sulfonic acid |
| SMILES | CC(CC1CC2CC1C1C3C=CC(C3)C21)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C16H21F3O3S/c1-15(16(17,18)19,23(20,21)22)7-11-5-10-6-12(11)14-9-3-2-8(4-9)13(10)14/h2-3,8-14H,4-7H2,1H3,(H,20,21,22) |
| InChIKey | UCHCXFTWZWRGGJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|