C24H29F3O11 — CID 58445663
(2-oxooxolan-3-yl) 9-(2,2-dimethylbutanoyloxy)-10-oxo-5'-(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,2'-cyclohexane]-1'-carboxylate (PubChem CID 58445663) has the molecular formula C24H29F3O11 and a molecular weight of 550.48 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 9-(2,2-dimethylbutanoyloxy)-10-oxo-5'-(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,2'-cyclohexane]-1'-carboxylate.
| Compound Name | (2-oxooxolan-3-yl) 9-(2,2-dimethylbutanoyloxy)-10-oxo-5'-(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,2'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 58445663 |
| Molecular Formula | C24H29F3O11 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | (2-oxooxolan-3-yl) 9-(2,2-dimethylbutanoyloxy)-10-oxo-5'-(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,2'-cyclohexane]-1'-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C3OC4(CCC(C(F)(F)F)CC4C(=O)OC4CCOC4=O)OC3OC12 |
| InChI | InChI=1S/C24H29F3O11/c1-4-22(2,3)21(31)36-15-13-14(34-19(15)30)16-20(35-13)38-23(37-16)7-5-10(24(25,26)27)9-11(23)17(28)33-12-6-8-32-18(12)29/h10-16,20H,4-9H2,1-3H3 |
| InChIKey | WRLRXGRDALANHE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|