About [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate
[2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 58445666) has the molecular formula C12H16F2O6
and a molecular weight of 294.25 g/mol. Its IUPAC name is [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate |
| PubChem CID | 58445666 |
| Molecular Formula | C12H16F2O6 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1CC(F)(F)OC1=O |
| InChI | InChI=1S/C12H16F2O6/c1-4-11(2,3)10(17)18-6-8(15)19-7-5-12(13,14)20-9(7)16/h7H,4-6H2,1-3H3 |
| InChIKey | ANXIICQBQWOCCJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate?
The IUPAC name of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate (CID 58445666) is [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate?
The canonical SMILES for [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCC(=O)OC1CC(F)(F)OC1=O.
What is the InChIKey of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate?
The InChIKey is ANXIICQBQWOCCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O6/c1-4-11(2,3)10(17)18-6-8(15)19-7-5-12(13,14)20-9(7)16/h7H,4-6H2,1-3H3.
What are the key properties of [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate?
[2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate has a molecular weight of 294.25 g/mol, XLogP of 1.42, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5,5-difluoro-2-oxooxolan-3-yl)oxy-2-oxoethyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 58445666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).