C16H18F5O5S- — CID 58445680
1,1,3,3,3-pentafluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonate (PubChem CID 58445680) has the molecular formula C16H18F5O5S- and a molecular weight of 417.37 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 58445680 |
| Molecular Formula | C16H18F5O5S- |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C16H19F5O5S/c17-15(18,19)14(16(20,21)27(23,24)25)26-13(22)10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h6-12,14H,1-5H2,(H,23,24,25)/p-1 |
| InChIKey | ZOTBVTXZECNKOR-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|