C20H13F7O6 — CID 58445703
[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 58445703) has the molecular formula C20H13F7O6 and a molecular weight of 482.30 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 58445703 |
| Molecular Formula | C20H13F7O6 |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2CC3C1OC(=O)C3(C(=O)Oc1c(F)c(F)c(C(F)(F)F)c(F)c1F)C2 |
| InChI | InChI=1S/C20H13F7O6/c1-5(2)16(28)31-13-6-3-7-14(13)32-17(29)19(7,4-6)18(30)33-15-11(23)9(21)8(20(25,26)27)10(22)12(15)24/h6-7,13-14H,1,3-4H2,2H3 |
| InChIKey | WMICSILMSBGRKH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|