C24H27F9O11 — CID 58445712
1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 3-O-(1,1,1-trifluoropropan-2-yl) 2-[[9-(2,2-dimethylbutanoyloxy)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]methyl]propanedioate (PubChem CID 58445712) has the molecular formula C24H27F9O11 and a molecular weight of 662.45 g/mol. Its IUPAC name is 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 3-O-(1,1,1-trifluoropropan-2-yl) 2-[[9-(2,2-dimethylbutanoyloxy)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]methyl]propanedioate.
| Compound Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 3-O-(1,1,1-trifluoropropan-2-yl) 2-[[9-(2,2-dimethylbutanoyloxy)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 58445712 |
| Molecular Formula | C24H27F9O11 |
| Molecular Weight | 662.45 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 3-O-(1,1,1-trifluoropropan-2-yl) 2-[[9-(2,2-dimethylbutanoyloxy)-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]methyl]propanedioate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C3OC(C)(CC(C(=O)OC(C)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F)OC3OC12 |
| InChI | InChI=1S/C24H27F9O11/c1-6-20(3,4)19(37)41-12-10-11(39-16(12)36)13-17(40-10)44-21(5,43-13)7-9(14(34)38-8(2)22(25,26)27)15(35)42-18(23(28,29)30)24(31,32)33/h8-13,17-18H,6-7H2,1-5H3 |
| InChIKey | JZOVCIMMDZSVGL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|