C11H15F3O3S — CID 58445721
3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonic acid (PubChem CID 58445721) has the molecular formula C11H15F3O3S and a molecular weight of 284.30 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonic acid.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 58445721 |
| Molecular Formula | C11H15F3O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonic acid |
| SMILES | CC(CC1CC2C=CC1C2)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C11H15F3O3S/c1-10(11(12,13)14,18(15,16)17)6-9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-6H2,1H3,(H,15,16,17) |
| InChIKey | XRBIIUPFHKXLLH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|