C21H27F3O10 — CID 58445725
[2',10-dioxo-3'-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl] 2,2-dimethylbutanoate (PubChem CID 58445725) has the molecular formula C21H27F3O10 and a molecular weight of 496.43 g/mol. Its IUPAC name is [2',10-dioxo-3'-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl] 2,2-dimethylbutanoate.
| Compound Name | [2',10-dioxo-3'-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58445725 |
| Molecular Formula | C21H27F3O10 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [2',10-dioxo-3'-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C3OC4(COC(=O)C4CCOC(C)C(F)(F)F)OC3OC12 |
| InChI | InChI=1S/C21H27F3O10/c1-5-19(3,4)18(27)32-13-11-12(30-16(13)26)14-17(31-11)34-20(33-14)8-29-15(25)10(20)6-7-28-9(2)21(22,23)24/h9-14,17H,5-8H2,1-4H3 |
| InChIKey | NUSGYBSFUDUZIV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|