C27H31F3O10 — CID 58445743
[5-oxo-6-(1,1,1-trifluoropropan-2-yloxycarbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 58445743) has the molecular formula C27H31F3O10 and a molecular weight of 572.53 g/mol. Its IUPAC name is [5-oxo-6-(1,1,1-trifluoropropan-2-yloxycarbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | [5-oxo-6-(1,1,1-trifluoropropan-2-yloxycarbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 58445743 |
| Molecular Formula | C27H31F3O10 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | [5-oxo-6-(1,1,1-trifluoropropan-2-yloxycarbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2CC3C1OC(=O)C3(C(=O)OC1C3CC4C1OC(=O)C4(C(=O)OC(C)C(F)(F)F)C3)C2 |
| InChI | InChI=1S/C27H31F3O10/c1-5-24(3,4)19(31)37-15-11-6-14-17(15)39-23(35)26(14,9-11)21(33)38-16-12-7-13-18(16)40-22(34)25(13,8-12)20(32)36-10(2)27(28,29)30/h10-18H,5-9H2,1-4H3 |
| InChIKey | ORSQIRFYLLOJMJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|