About 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid
2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid (PubChem CID 58445747) has the molecular formula C9H12F2O3S
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid.
Molecular Properties
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid |
| PubChem CID | 58445747 |
| Molecular Formula | C9H12F2O3S |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C9H12F2O3S/c10-9(11,15(12,13)14)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,12,13,14) |
| InChIKey | HPPTXRKEBRSGGO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
The IUPAC name of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid (CID 58445747) is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid.
What is the SMILES notation for 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
The canonical SMILES for 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid is O=S(=O)(O)C(F)(F)CC1CC2C=CC1C2.
What is the InChIKey of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
The InChIKey is HPPTXRKEBRSGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O3S/c10-9(11,15(12,13)14)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,12,13,14).
What are the key properties of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid has a molecular weight of 238.25 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid is sourced from PubChem (CID 58445747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).