2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid

C9H12F2O3S — CID 58445747

IUPAC2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid
SMILESO=S(=O)(O)C(F)(F)CC1CC2C=CC1C2
InChIInChI=1S/C9H12F2O3S/c10-9(11,15(12,13)14)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,12,13,14)
InChIKeyHPPTXRKEBRSGGO-UHFFFAOYSA-N
MW238.25 g/mol
LogP2.07
Rot. Bonds3

About 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid

2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid (PubChem CID 58445747) has the molecular formula C9H12F2O3S and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid.

Molecular Properties

Compound Name2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid
PubChem CID58445747
Molecular FormulaC9H12F2O3S
Molecular Weight238.25 g/mol
Exact Mass238.05
IUPAC Name2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid
SMILESO=S(=O)(O)C(F)(F)CC1CC2C=CC1C2
InChIInChI=1S/C9H12F2O3S/c10-9(11,15(12,13)14)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,12,13,14)
InChIKeyHPPTXRKEBRSGGO-UHFFFAOYSA-N
XLogP2.07
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.25
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
The IUPAC name of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid (CID 58445747) is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid.
What is the SMILES notation for 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
The canonical SMILES for 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid is O=S(=O)(O)C(F)(F)CC1CC2C=CC1C2.
What is the InChIKey of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
The InChIKey is HPPTXRKEBRSGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O3S/c10-9(11,15(12,13)14)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,12,13,14).
What are the key properties of 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid?
2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid has a molecular weight of 238.25 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonic acid is sourced from PubChem (CID 58445747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).