C16H17F3O9 — CID 58445762
(2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 58445762) has the molecular formula C16H17F3O9 and a molecular weight of 410.30 g/mol. Its IUPAC name is (2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | (2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 58445762 |
| Molecular Formula | C16H17F3O9 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1C(=O)OC2C3OC4(COC(=O)C4)OC3OC12)C(F)(F)F |
| InChI | InChI=1S/C16H17F3O9/c1-3-14(2,16(17,18)19)13(22)26-9-7-8(24-11(9)21)10-12(25-7)28-15(27-10)4-6(20)23-5-15/h7-10,12H,3-5H2,1-2H3 |
| InChIKey | IQYDGHBHSXKUST-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|