C26H36N6O4 — CID 58445829
2-amino-N-[3-(dimethylamino)propyl]-9-[[3-formamidopropyl(methyl)amino]methyl]-4,6-dimethyl-3-oxophenoxazine-1-carboxamide (PubChem CID 58445829) has the molecular formula C26H36N6O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylamino)propyl]-9-[[3-formamidopropyl(methyl)amino]methyl]-4,6-dimethyl-3-oxophenoxazine-1-carboxamide.
| Compound Name | 2-amino-N-[3-(dimethylamino)propyl]-9-[[3-formamidopropyl(methyl)amino]methyl]-4,6-dimethyl-3-oxophenoxazine-1-carboxamide |
|---|---|
| PubChem CID | 58445829 |
| Molecular Formula | C26H36N6O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 2-amino-N-[3-(dimethylamino)propyl]-9-[[3-formamidopropyl(methyl)amino]methyl]-4,6-dimethyl-3-oxophenoxazine-1-carboxamide |
| SMILES | Cc1c2oc3c(C)ccc(CN(C)CCCNC=O)c3nc-2c(C(=O)NCCCN(C)C)c(N)c1=O |
| InChI | InChI=1S/C26H36N6O4/c1-16-8-9-18(14-32(5)13-6-10-28-15-33)21-24(16)36-25-17(2)23(34)20(27)19(22(25)30-21)26(35)29-11-7-12-31(3)4/h8-9,15H,6-7,10-14,27H2,1-5H3,(H,28,33)(H,29,35) |
| InChIKey | WJXPEWNHUKPMIA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|