About N-(azidomethyl)acetamide
N-(azidomethyl)acetamide (PubChem CID 58445939) has the molecular formula C3H6N4O
and a molecular weight of 114.11 g/mol. Its IUPAC name is N-(azidomethyl)acetamide.
Molecular Properties
| Compound Name | N-(azidomethyl)acetamide |
| PubChem CID | 58445939 |
| Molecular Formula | C3H6N4O |
| Molecular Weight | 114.11 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | N-(azidomethyl)acetamide |
| SMILES | CC(=O)NCN=[N+]=[N-] |
| InChI | InChI=1S/C3H6N4O/c1-3(8)5-2-6-7-4/h2H2,1H3,(H,5,8) |
| InChIKey | NSOTYTGNUDYMEO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.11 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(azidomethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azidomethyl)acetamide?
The IUPAC name of N-(azidomethyl)acetamide (CID 58445939) is N-(azidomethyl)acetamide.
What is the SMILES notation for N-(azidomethyl)acetamide?
The canonical SMILES for N-(azidomethyl)acetamide is CC(=O)NCN=[N+]=[N-].
What is the InChIKey of N-(azidomethyl)acetamide?
The InChIKey is NSOTYTGNUDYMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O/c1-3(8)5-2-6-7-4/h2H2,1H3,(H,5,8).
What are the key properties of N-(azidomethyl)acetamide?
N-(azidomethyl)acetamide has a molecular weight of 114.11 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azidomethyl)acetamide is sourced from PubChem (CID 58445939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).