About 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid
6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid (PubChem CID 58445948) has the molecular formula C9H7F3N2O3
and a molecular weight of 248.16 g/mol. Its IUPAC name is 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid |
| PubChem CID | 58445948 |
| Molecular Formula | C9H7F3N2O3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C9H7F3N2O3/c10-9(11,12)8(17)14-4-6-2-1-5(3-13-6)7(15)16/h1-3H,4H2,(H,14,17)(H,15,16) |
| InChIKey | MBRXRWSCLNYVHE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid?
The IUPAC name of 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid (CID 58445948) is 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid is O=C(O)c1ccc(CNC(=O)C(F)(F)F)nc1.
What is the InChIKey of 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid?
The InChIKey is MBRXRWSCLNYVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2O3/c10-9(11,12)8(17)14-4-6-2-1-5(3-13-6)7(15)16/h1-3H,4H2,(H,14,17)(H,15,16).
What are the key properties of 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid?
6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid has a molecular weight of 248.16 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2,2,2-trifluoroacetyl)amino]methyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 58445948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).