C22H22N6O2 — CID 58445953
N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-ethylbenzamide (PubChem CID 58445953) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-ethylbenzamide.
| Compound Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 58445953 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NCc2ccc(COc3nc(N)nc4nc[nH]c34)cc2)cc1 |
| InChI | InChI=1S/C22H22N6O2/c1-2-14-7-9-17(10-8-14)20(29)24-11-15-3-5-16(6-4-15)12-30-21-18-19(26-13-25-18)27-22(23)28-21/h3-10,13H,2,11-12H2,1H3,(H,24,29)(H3,23,25,26,27,28) |
| InChIKey | BIWUVCLRSCUVSO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |