C29H32FN3O6 — CID 58446270
1-O-benzyl 4-O-tert-butyl (3R,3aR,6R,6aS)-6-acetyloxy-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate (PubChem CID 58446270) has the molecular formula C29H32FN3O6 and a molecular weight of 537.59 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl (3R,3aR,6R,6aS)-6-acetyloxy-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl (3R,3aR,6R,6aS)-6-acetyloxy-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58446270 |
| Molecular Formula | C29H32FN3O6 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl (3R,3aR,6R,6aS)-6-acetyloxy-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
| SMILES | CC(=O)O[C@@H]1CN(C(=O)OC(C)(C)C)[C@H]2[C@@H]1N(C(=O)OCc1ccccc1)C[C@H]2c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C29H32FN3O6/c1-17(34)38-24-15-33(28(36)39-29(2,3)4)25-22(21-13-31-23-12-19(30)10-11-20(21)23)14-32(26(24)25)27(35)37-16-18-8-6-5-7-9-18/h5-13,22,24-26,31H,14-16H2,1-4H3/t22-,24+,25+,26+/m0/s1 |
| InChIKey | NKAJYLIPXWYKNT-DZWGLGNASA-N |
| XLogP | 4.96 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|