C32H37FN4O5 — CID 58446277
benzyl (3R,3aR,6R,6aS)-6-acetyloxy-4-[(2S)-2-amino-2-cyclohexylacetyl]-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 58446277) has the molecular formula C32H37FN4O5 and a molecular weight of 576.67 g/mol. Its IUPAC name is benzyl (3R,3aR,6R,6aS)-6-acetyloxy-4-[(2S)-2-amino-2-cyclohexylacetyl]-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | benzyl (3R,3aR,6R,6aS)-6-acetyloxy-4-[(2S)-2-amino-2-cyclohexylacetyl]-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 58446277 |
| Molecular Formula | C32H37FN4O5 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | benzyl (3R,3aR,6R,6aS)-6-acetyloxy-4-[(2S)-2-amino-2-cyclohexylacetyl]-3-(6-fluoro-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | CC(=O)O[C@@H]1CN(C(=O)[C@@H](N)C2CCCCC2)[C@H]2[C@@H]1N(C(=O)OCc1ccccc1)C[C@H]2c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C32H37FN4O5/c1-19(38)42-27-17-36(31(39)28(34)21-10-6-3-7-11-21)29-25(24-15-35-26-14-22(33)12-13-23(24)26)16-37(30(27)29)32(40)41-18-20-8-4-2-5-9-20/h2,4-5,8-9,12-15,21,25,27-30,35H,3,6-7,10-11,16-18,34H2,1H3/t25-,27+,28-,29+,30+/m0/s1 |
| InChIKey | LMTVEDDFBOZJLM-VDKDFJRPSA-N |
| XLogP | 4.46 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |