About methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate
methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate (PubChem CID 58446628) has the molecular formula C17H30O3Si
and a molecular weight of 310.51 g/mol. Its IUPAC name is methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate.
Molecular Properties
| Compound Name | methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate |
| PubChem CID | 58446628 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate |
| SMILES | C=C1[C@H](C)C/C(=C/C(=O)OC)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-12-9-14(11-16(18)19-6)10-15(13(12)2)20-21(7,8)17(3,4)5/h11-12,15H,2,9-10H2,1,3-8H3/b14-11-/t12-,15-/m1/s1 |
| InChIKey | PUWFZYRNNLCPPD-DNWXMTRLSA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate?
The IUPAC name of methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate (CID 58446628) is methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate.
What is the SMILES notation for methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate?
The canonical SMILES for methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate is C=C1[C@H](C)C/C(=C/C(=O)OC)C[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate?
The InChIKey is PUWFZYRNNLCPPD-DNWXMTRLSA-N. The full InChI is InChI=1S/C17H30O3Si/c1-12-9-14(11-16(18)19-6)10-15(13(12)2)20-21(7,8)17(3,4)5/h11-12,15H,2,9-10H2,1,3-8H3/b14-11-/t12-,15-/m1/s1.
What are the key properties of methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate?
methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate has a molecular weight of 310.51 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-[(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-methylidenecyclohexylidene]acetate is sourced from PubChem (CID 58446628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).