C21H37N — CID 58446707
2-[(1S)-1-[(4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethyl]-5,5-dimethylhexanenitrile (PubChem CID 58446707) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is 2-[(1S)-1-[(4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethyl]-5,5-dimethylhexanenitrile.
| Compound Name | 2-[(1S)-1-[(4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethyl]-5,5-dimethylhexanenitrile |
|---|---|
| PubChem CID | 58446707 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | 2-[(1S)-1-[(4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethyl]-5,5-dimethylhexanenitrile |
| SMILES | C[C@H](C(C#N)CCC(C)(C)C)C1CCC2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C21H37N/c1-15-8-7-12-21(6)18(15)9-10-19(21)16(2)17(14-22)11-13-20(3,4)5/h15-19H,7-13H2,1-6H3/t15-,16+,17?,18?,19?,21-/m0/s1 |
| InChIKey | PBAZYFQGLWNWLV-AYTSQOJNSA-N |
| XLogP | 6.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |