C21H35NO3S — CID 58446736
(1R,4S)-4,7,7-trimethyl-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonylmethyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 58446736) has the molecular formula C21H35NO3S and a molecular weight of 381.58 g/mol. Its IUPAC name is (1R,4S)-4,7,7-trimethyl-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonylmethyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4S)-4,7,7-trimethyl-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonylmethyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 58446736 |
| Molecular Formula | C21H35NO3S |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (1R,4S)-4,7,7-trimethyl-1-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonylmethyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)CC2CC(C)(CN2S(=O)(=O)C[C@@]23CC[C@@](C)(CC2=O)C3(C)C)C1 |
| InChI | InChI=1S/C21H35NO3S/c1-17(2)9-15-10-19(5,12-17)13-22(15)26(24,25)14-21-8-7-20(6,11-16(21)23)18(21,3)4/h15H,7-14H2,1-6H3/t15?,19?,20-,21-/m0/s1 |
| InChIKey | RAYWQIUMCJYZOQ-NYZJOLKASA-N |
| XLogP | 4.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |