C26H26F2N4O2S — CID 58446769
5-(benzenesulfinyl)-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 58446769) has the molecular formula C26H26F2N4O2S and a molecular weight of 496.58 g/mol. Its IUPAC name is 5-(benzenesulfinyl)-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-(benzenesulfinyl)-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 58446769 |
| Molecular Formula | C26H26F2N4O2S |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 5-(benzenesulfinyl)-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(cn(Cc3ccc(C(C)(F)F)cc3)c2S(=O)c2ccccc2)N2CC(C)(C)N=C12 |
| InChI | InChI=1S/C26H26F2N4O2S/c1-25(2)16-32-20-15-31(14-17-10-12-18(13-11-17)26(3,27)28)23(35(34)19-8-6-5-7-9-19)21(20)22(33)30(4)24(32)29-25/h5-13,15H,14,16H2,1-4H3 |
| InChIKey | QKWVASRADQENIN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |