C27H29FN4OS — CID 58446771
5-(4-fluorophenyl)sulfanyl-3,8,12,12-tetramethyl-4-[(4-methylphenyl)methyl]-1,4,8,10-tetrazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one (PubChem CID 58446771) has the molecular formula C27H29FN4OS and a molecular weight of 476.62 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfanyl-3,8,12,12-tetramethyl-4-[(4-methylphenyl)methyl]-1,4,8,10-tetrazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one.
| Compound Name | 5-(4-fluorophenyl)sulfanyl-3,8,12,12-tetramethyl-4-[(4-methylphenyl)methyl]-1,4,8,10-tetrazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 58446771 |
| Molecular Formula | C27H29FN4OS |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 5-(4-fluorophenyl)sulfanyl-3,8,12,12-tetramethyl-4-[(4-methylphenyl)methyl]-1,4,8,10-tetrazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one |
| SMILES | Cc1ccc(Cn2c(C)c3c(c2Sc2ccc(F)cc2)C(=O)N(C)C2=NCC(C)(C)CN23)cc1 |
| InChI | InChI=1S/C27H29FN4OS/c1-17-6-8-19(9-7-17)14-31-18(2)23-22(25(31)34-21-12-10-20(28)11-13-21)24(33)30(5)26-29-15-27(3,4)16-32(23)26/h6-13H,14-16H2,1-5H3 |
| InChIKey | GXAFAEJIGSSCPE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 40.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |