C27H28F2N4O — CID 58446776
5-benzyl-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 58446776) has the molecular formula C27H28F2N4O and a molecular weight of 462.54 g/mol. Its IUPAC name is 5-benzyl-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-benzyl-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 58446776 |
| Molecular Formula | C27H28F2N4O |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 5-benzyl-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8,11,11-trimethyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(cn(Cc3ccc(C(C)(F)F)cc3)c2Cc2ccccc2)N2CC(C)(C)N=C12 |
| InChI | InChI=1S/C27H28F2N4O/c1-26(2)17-33-22-16-32(15-19-10-12-20(13-11-19)27(3,28)29)21(14-18-8-6-5-7-9-18)23(22)24(34)31(4)25(33)30-26/h5-13,16H,14-15,17H2,1-4H3 |
| InChIKey | GSRIGHJHXBJWNB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 40.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |