C27H29F2N5O — CID 58446789
(11R)-5-anilino-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-11-propan-2-yl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 58446789) has the molecular formula C27H29F2N5O and a molecular weight of 477.56 g/mol. Its IUPAC name is (11R)-5-anilino-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-11-propan-2-yl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | (11R)-5-anilino-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-11-propan-2-yl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 58446789 |
| Molecular Formula | C27H29F2N5O |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (11R)-5-anilino-4-[[4-(1,1-difluoroethyl)phenyl]methyl]-8-methyl-11-propan-2-yl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CC(C)[C@@H]1CN2C(=N1)N(C)C(=O)c1c2cn(Cc2ccc(C(C)(F)F)cc2)c1Nc1ccccc1 |
| InChI | InChI=1S/C27H29F2N5O/c1-17(2)21-15-34-22-16-33(14-18-10-12-19(13-11-18)27(3,28)29)24(30-20-8-6-5-7-9-20)23(22)25(35)32(4)26(34)31-21/h5-13,16-17,21,30H,14-15H2,1-4H3/t21-/m0/s1 |
| InChIKey | YNTCNEMQQACJME-NRFANRHFSA-N |
| XLogP | 5.68 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |