C22H19N7O2 — CID 58446966
N-(cyanomethyl)-N,1-dimethyl-5-[2-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)acetyl]pyrazole-4-carboxamide (PubChem CID 58446966) has the molecular formula C22H19N7O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(cyanomethyl)-N,1-dimethyl-5-[2-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)acetyl]pyrazole-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N,1-dimethyl-5-[2-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)acetyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 58446966 |
| Molecular Formula | C22H19N7O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-(cyanomethyl)-N,1-dimethyl-5-[2-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)acetyl]pyrazole-4-carboxamide |
| SMILES | CN(CC#N)C(=O)c1cnn(C)c1C(=O)Cc1ccn2cc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C22H19N7O2/c1-27(11-9-23)21(31)17-13-24-28(2)20(17)19(30)12-16-8-10-29-14-18(26-22(29)25-16)15-6-4-3-5-7-15/h3-8,10,13-14H,11-12H2,1-2H3 |
| InChIKey | HFKJBEHKMZWCBJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|