C22H18N6O — CID 58447654
2-(3-methyl-4-pyridazin-4-ylphenyl)-N-(5-pyrazin-2-yl-2-pyridinyl)acetamide (PubChem CID 58447654) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-(3-methyl-4-pyridazin-4-ylphenyl)-N-(5-pyrazin-2-yl-2-pyridinyl)acetamide.
| Compound Name | 2-(3-methyl-4-pyridazin-4-ylphenyl)-N-(5-pyrazin-2-yl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 58447654 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-(3-methyl-4-pyridazin-4-ylphenyl)-N-(5-pyrazin-2-yl-2-pyridinyl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(-c3cnccn3)cn2)ccc1-c1ccnnc1 |
| InChI | InChI=1S/C22H18N6O/c1-15-10-16(2-4-19(15)17-6-7-26-27-13-17)11-22(29)28-21-5-3-18(12-25-21)20-14-23-8-9-24-20/h2-10,12-14H,11H2,1H3,(H,25,28,29) |
| InChIKey | ZKONYOBJCLDGBS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |