C24H16FN5O — CID 58447671
2-[3-cyano-4-(2-fluoro-4-pyridinyl)phenyl]-N-(5-pyridin-2-yl-2-pyridinyl)acetamide (PubChem CID 58447671) has the molecular formula C24H16FN5O and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-[3-cyano-4-(2-fluoro-4-pyridinyl)phenyl]-N-(5-pyridin-2-yl-2-pyridinyl)acetamide.
| Compound Name | 2-[3-cyano-4-(2-fluoro-4-pyridinyl)phenyl]-N-(5-pyridin-2-yl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 58447671 |
| Molecular Formula | C24H16FN5O |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[3-cyano-4-(2-fluoro-4-pyridinyl)phenyl]-N-(5-pyridin-2-yl-2-pyridinyl)acetamide |
| SMILES | N#Cc1cc(CC(=O)Nc2ccc(-c3ccccn3)cn2)ccc1-c1ccnc(F)c1 |
| InChI | InChI=1S/C24H16FN5O/c25-22-13-17(8-10-28-22)20-6-4-16(11-19(20)14-26)12-24(31)30-23-7-5-18(15-29-23)21-3-1-2-9-27-21/h1-11,13,15H,12H2,(H,29,30,31) |
| InChIKey | PVTMPWBIAGLLHG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|