C21H19N7O2 — CID 58448560
2-amino-6-[3-[2-(2-isocyanoimidazo[1,2-a]pyrazin-6-yl)-2-oxoethyl]phenyl]-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 58448560) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 2-amino-6-[3-[2-(2-isocyanoimidazo[1,2-a]pyrazin-6-yl)-2-oxoethyl]phenyl]-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | 2-amino-6-[3-[2-(2-isocyanoimidazo[1,2-a]pyrazin-6-yl)-2-oxoethyl]phenyl]-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 58448560 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-amino-6-[3-[2-(2-isocyanoimidazo[1,2-a]pyrazin-6-yl)-2-oxoethyl]phenyl]-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | [C-]#[N+]c1cn2cc(C(=O)Cc3cccc(C4(C)CC(=O)N(C)C(N)=N4)c3)ncc2n1 |
| InChI | InChI=1S/C21H19N7O2/c1-21(9-19(30)27(3)20(22)26-21)14-6-4-5-13(7-14)8-16(29)15-11-28-12-17(23-2)25-18(28)10-24-15/h4-7,10-12H,8-9H2,1,3H3,(H2,22,26) |
| InChIKey | NMLHKSBWRTWJBJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|