C24H29NO — CID 58449390
3-cyclohexyl-N-(cyclopropylmethyl)-5-(4-methylphenyl)benzamide (PubChem CID 58449390) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is 3-cyclohexyl-N-(cyclopropylmethyl)-5-(4-methylphenyl)benzamide.
| Compound Name | 3-cyclohexyl-N-(cyclopropylmethyl)-5-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 58449390 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 3-cyclohexyl-N-(cyclopropylmethyl)-5-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCC3CC3)cc(C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C24H29NO/c1-17-7-11-20(12-8-17)22-13-21(19-5-3-2-4-6-19)14-23(15-22)24(26)25-16-18-9-10-18/h7-8,11-15,18-19H,2-6,9-10,16H2,1H3,(H,25,26) |
| InChIKey | MMYVYJLYDXQMMA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |