About 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine
1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine (PubChem CID 58449484) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine.
Analyze 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine?
The IUPAC name of 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine (CID 58449484) is 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine.
What is the SMILES notation for 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine?
The canonical SMILES for 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine is CC1CCN(C)C2=C1CC=C2.
What is the InChIKey of 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine?
The InChIKey is KGHYXAPNGQODJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-8-6-7-11(2)10-5-3-4-9(8)10/h3,5,8H,4,6-7H2,1-2H3.
What are the key properties of 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine?
1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine has a molecular weight of 149.24 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]pyridine is sourced from PubChem (CID 58449484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).