C23H24F2N2O — CID 58449952
2-(2,4-difluorophenyl)-1-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propan-2-ol (PubChem CID 58449952) has the molecular formula C23H24F2N2O and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 58449952 |
| Molecular Formula | C23H24F2N2O |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)propan-2-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C)(O)c2ccc(F)cc2F)CN2CCC1C2 |
| InChI | InChI=1S/C23H24F2N2O/c1-14-3-6-20-17(9-14)22-15-7-8-26(11-15)12-21(22)27(20)13-23(2,28)18-5-4-16(24)10-19(18)25/h3-6,9-10,15,28H,7-8,11-13H2,1-2H3 |
| InChIKey | RONISSALXHSMLV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|