C18H23N3O — CID 58449992
N,N-dimethyl-2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)acetamide (PubChem CID 58449992) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)acetamide |
|---|---|
| PubChem CID | 58449992 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N,N-dimethyl-2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)acetamide |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(=O)N(C)C)CN2CCC1C2 |
| InChI | InChI=1S/C18H23N3O/c1-12-4-5-15-14(8-12)18-13-6-7-20(9-13)10-16(18)21(15)11-17(22)19(2)3/h4-5,8,13H,6-7,9-11H2,1-3H3 |
| InChIKey | KHMVUHNIGYSWBZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|