C18H21ClN2O2 — CID 58450012
ethyl 2-(6-chloro-1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetate (PubChem CID 58450012) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is ethyl 2-(6-chloro-1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetate.
| Compound Name | ethyl 2-(6-chloro-1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetate |
|---|---|
| PubChem CID | 58450012 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 2-(6-chloro-1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(Cl)ccc31)CC1CCCN1C2 |
| InChI | InChI=1S/C18H21ClN2O2/c1-2-23-18(22)11-21-16-6-5-12(19)8-14(16)15-9-13-4-3-7-20(13)10-17(15)21/h5-6,8,13H,2-4,7,9-11H2,1H3 |
| InChIKey | GYVZLGZVOJCFTN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|