About CID 58450196
CID 58450196 (PubChem CID 58450196) has the molecular formula C8H9F3N2O
and a molecular weight of 206.17 g/mol.
Molecular Properties
| Compound Name | CID 58450196 |
| PubChem CID | 58450196 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | — |
| SMILES | [CH]OC(c1cnc(C)n1C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O/c1-5-12-4-6(13(5)2)7(14-3)8(9,10)11/h3-4,7H,1-2H3 |
| InChIKey | IIKHONWOHWDSIE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58450196 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58450196?
The IUPAC name of CID 58450196 (CID 58450196) is not available.
What is the SMILES notation for CID 58450196?
The canonical SMILES for CID 58450196 is [CH]OC(c1cnc(C)n1C)C(F)(F)F.
What is the InChIKey of CID 58450196?
The InChIKey is IIKHONWOHWDSIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O/c1-5-12-4-6(13(5)2)7(14-3)8(9,10)11/h3-4,7H,1-2H3.
What are the key properties of CID 58450196?
CID 58450196 has a molecular weight of 206.17 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58450196 is sourced from PubChem (CID 58450196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).