About 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one
1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one (PubChem CID 58450207) has the molecular formula C9H10F3NO2
and a molecular weight of 221.18 g/mol. Its IUPAC name is 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one |
| PubChem CID | 58450207 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one |
| SMILES | COC(c1ccn(C)c(=O)c1)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO2/c1-13-4-3-6(5-7(13)14)8(15-2)9(10,11)12/h3-5,8H,1-2H3 |
| InChIKey | UGJPOADIFPGKRC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one?
The IUPAC name of 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one (CID 58450207) is 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one.
What is the SMILES notation for 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one?
The canonical SMILES for 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one is COC(c1ccn(C)c(=O)c1)C(F)(F)F.
What is the InChIKey of 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one?
The InChIKey is UGJPOADIFPGKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO2/c1-13-4-3-6(5-7(13)14)8(15-2)9(10,11)12/h3-5,8H,1-2H3.
What are the key properties of 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one?
1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one has a molecular weight of 221.18 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(2,2,2-trifluoro-1-methoxyethyl)pyridin-2-one is sourced from PubChem (CID 58450207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).