About 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane
4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane (PubChem CID 58450265) has the molecular formula C8H12F4O2
and a molecular weight of 216.17 g/mol. Its IUPAC name is 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane.
Molecular Properties
| Compound Name | 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane |
| PubChem CID | 58450265 |
| Molecular Formula | C8H12F4O2 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane |
| SMILES | COC(C(F)(F)F)C1(F)CCOCC1 |
| InChI | InChI=1S/C8H12F4O2/c1-13-6(8(10,11)12)7(9)2-4-14-5-3-7/h6H,2-5H2,1H3 |
| InChIKey | HWJNAABQZRPUNC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane?
The IUPAC name of 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane (CID 58450265) is 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane.
What is the SMILES notation for 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane?
The canonical SMILES for 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane is COC(C(F)(F)F)C1(F)CCOCC1.
What is the InChIKey of 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane?
The InChIKey is HWJNAABQZRPUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F4O2/c1-13-6(8(10,11)12)7(9)2-4-14-5-3-7/h6H,2-5H2,1H3.
What are the key properties of 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane?
4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane has a molecular weight of 216.17 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)oxane is sourced from PubChem (CID 58450265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).