About 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone
1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone (PubChem CID 58450378) has the molecular formula C10H15F4NO2
and a molecular weight of 257.23 g/mol. Its IUPAC name is 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone |
| PubChem CID | 58450378 |
| Molecular Formula | C10H15F4NO2 |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone |
| SMILES | COC(C(F)(F)F)C1(F)CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C10H15F4NO2/c1-7(16)15-5-3-9(11,4-6-15)8(17-2)10(12,13)14/h8H,3-6H2,1-2H3 |
| InChIKey | GFAMEHUDTZLAGD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone (CID 58450378) is 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone is COC(C(F)(F)F)C1(F)CCN(C(C)=O)CC1.
What is the InChIKey of 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone?
The InChIKey is GFAMEHUDTZLAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F4NO2/c1-7(16)15-5-3-9(11,4-6-15)8(17-2)10(12,13)14/h8H,3-6H2,1-2H3.
What are the key properties of 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone?
1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone has a molecular weight of 257.23 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-fluoro-4-(2,2,2-trifluoro-1-methoxyethyl)piperidin-1-yl]ethanone is sourced from PubChem (CID 58450378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).