C12H12ClN3O3 — CID 58451188
(1S,2R,5R)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol (PubChem CID 58451188) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is (1S,2R,5R)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 58451188 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (1S,2R,5R)-5-(4-chloroimidazo[4,5-c]pyridin-3-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
| SMILES | OCC1=C[C@@H](n2cnc3ccnc(Cl)c32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H12ClN3O3/c13-12-9-7(1-2-14-12)15-5-16(9)8-3-6(4-17)10(18)11(8)19/h1-3,5,8,10-11,17-19H,4H2/t8-,10-,11+/m1/s1 |
| InChIKey | INBWBLBXBBVCDL-IEBDPFPHSA-N |
| XLogP | 0.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|