About 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one
3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one (PubChem CID 58451645) has the molecular formula C19H26O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one |
| PubChem CID | 58451645 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one |
| SMILES | CC(C(=O)c1ccccc1)C(O)C1CCC2CC1C2(C)C |
| InChI | InChI=1S/C19H26O2/c1-12(17(20)13-7-5-4-6-8-13)18(21)15-10-9-14-11-16(15)19(14,2)3/h4-8,12,14-16,18,21H,9-11H2,1-3H3 |
| InChIKey | BLHYNNNWMPIQGL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one?
The IUPAC name of 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one (CID 58451645) is 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one.
What is the SMILES notation for 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one?
The canonical SMILES for 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one is CC(C(=O)c1ccccc1)C(O)C1CCC2CC1C2(C)C.
What is the InChIKey of 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one?
The InChIKey is BLHYNNNWMPIQGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O2/c1-12(17(20)13-7-5-4-6-8-13)18(21)15-10-9-14-11-16(15)19(14,2)3/h4-8,12,14-16,18,21H,9-11H2,1-3H3.
What are the key properties of 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one?
3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one has a molecular weight of 286.42 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)-3-hydroxy-2-methyl-1-phenylpropan-1-one is sourced from PubChem (CID 58451645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).